Perospiron – Wikipedija / Википедија

Perospiron
(IUPAC) ime
(3aR,7aS)-24-[4-(1,2-benzizotiazol-3-il)piperazin-1-il]butil
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

heksahidro-1H-izoindol-1,3(2H)-dion

| image = Perospirone.png | width = | image2 = | width2 =

| tradename = Lulan | Drugs.com = Internacionalno ime leka | pregnancy_category = | legal_status = Rx-only | routes_of_administration = Oralnot

| bioavailability = | metabolism = | elimination_half-life = 2-2,5 sata | excretion =

| CAS_number_Ref =  DaY | CAS_number = 150915-41-6 | ATC_prefix = none | ATC_suffix = | PubChem = 115368 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref =  DaY | ChemSpiderID = 16737064 | UNII_Ref =  DaY | UNII = N303OK87DT

| C=23 | H=30 | N=4 | O=2 | S=1 | molecular_weight = 426,57 g/mol | smiles = O=C4N(CCCCN1CCN(CC1)C\3=N\SCc2ccccc2/3)C(=O)[C@@H]5CCCC[C@H]45 | InChI = 1/C24H32N4O2S/c29-23-20-9-3-4-10-21(20)24(30)28(23)12-6-5-11-26-13-15-27(16-14-26)22-19-8-2-1-7-18(19)17-31-25-22/h1-2,7-8,20-21H,3-6,9-17H2/t20-,21+ | InChIKey = GTAIPSDXDDTGBZ-OYRHEFFEBD | StdInChI_Ref =  DaY | StdInChI = 1S/C24H32N4O2S/c29-23-20-9-3-4-10-21(20)24(30)28(23)12-6-5-11-26-13-15-27(16-14-26)22-19-8-2-1-7-18(19)17-31-25-22/h1-2,7-8,20-21H,3-6,9-17H2/t20-,21+ | StdInChIKey_Ref =  DaY | StdInChIKey = GTAIPSDXDDTGBZ-OYRHEFFESA-N }}

Perospiron (Lulan) je atipični antipsihotik iz azapironske hemijske klase.[1] Njega je razvila japanska kompanija Dajnipon sumitomo farma 2001 za lečenje šizofrenije i akutne bipolarne manije.[2][3] Perospiron deluje kao parcijalni agonist 5-HT1A receptora, inverzni agonist 5-HT2A receptora i antagonist D2, D4 i α1-adrenergičkog receptora.[4][5][6][7]

Reference

[uredi | uredi kod]
  1. Onrust SV, McClellan K (2001). „Perospirone”. CNS Drugs 15 (4): 329–37; discussion 338. DOI:10.2165/00023210-200115040-00006. PMID 11463136. 
  2. de Paulis T (January 2002). „Perospirone (Sumitomo Pharmaceuticals)”. Current Opinion in Investigational Drugs (London, England : 2000) 3 (1): 121–9. PMID 12054062. 
  3. „Sumitomo Pharmaceuticals 2001 | News Release | Dainippon Sumitomo Pharma”. Arhivirano iz originala na datum 2006-02-24. 
  4. Hirose A, Kato T, Ohno Y, et al. (July 1990). „Pharmacological actions of SM-9018, a new neuroleptic drug with both potent 5-hydroxytryptamine2 and dopamine2 antagonistic actions”. Japanese Journal of Pharmacology 53 (3): 321–9. DOI:10.1254/jjp.53.321. PMID 1975278. 
  5. Kato T, Hirose A, Ohno Y, Shimizu H, Tanaka H, Nakamura M (December 1990). „Binding profile of SM-9018, a novel antipsychotic candidate”. Japanese Journal of Pharmacology 54 (4): 478–81. DOI:10.1254/jjp.54.478. PMID 1982326. 
  6. Odagaki Y, Toyoshima R (2007). „5-HT1A receptor agonist properties of antipsychotics determined by [35SGTPgammaS binding in rat hippocampal membranes”]. Clinical and Experimental Pharmacology & Physiology 34 (5–6): 462–6. DOI:10.1111/j.1440-1681.2007.04595.x. PMID 17439416. Arhivirano iz originala na datum 2013-01-05. Pristupljeno 2014-04-05. 
  7. Seeman P, Tallerico T (March 1998). „Antipsychotic drugs which elicit little or no parkinsonism bind more loosely than dopamine to brain D2 receptors, yet occupy high levels of these receptors”. Molecular Psychiatry 3 (2): 123–34. DOI:10.1038/sj.mp.4000336. PMID 9577836. 

Povezano

[uredi | uredi kod]

Vanjske veze

[uredi | uredi kod]